C9H14BF6N — CID 14764082
1,1,4-trimethyl-2,2-bis(trifluoromethyl)-1-azonia-2-boranuidacyclohex-4-ene (PubChem CID 14764082) has the molecular formula C9H14BF6N and a molecular weight of 261.02 g/mol. Its IUPAC name is 1,1,4-trimethyl-2,2-bis(trifluoromethyl)-1-azonia-2-boranuidacyclohex-4-ene.
| Compound Name | 1,1,4-trimethyl-2,2-bis(trifluoromethyl)-1-azonia-2-boranuidacyclohex-4-ene |
|---|---|
| PubChem CID | 14764082 |
| Molecular Formula | C9H14BF6N |
| Molecular Weight | 261.02 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | 1,1,4-trimethyl-2,2-bis(trifluoromethyl)-1-azonia-2-boranuidacyclohex-4-ene |
| SMILES | CC1=CC[N+](C)(C)[B-](C(F)(F)F)(C(F)(F)F)C1 |
| InChI | InChI=1S/C9H14BF6N/c1-7-4-5-17(2,3)10(6-7,8(11,12)13)9(14,15)16/h4H,5-6H2,1-3H3 |
| InChIKey | QSKSUCKGLPUYRQ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.02 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|