C15H22O3S — CID 134906542
(4R)-4-(benzenesulfonylmethyl)-5,5-dimethylhexan-2-one (PubChem CID 134906542) has the molecular formula C15H22O3S and a molecular weight of 282.40 g/mol. Its IUPAC name is (4R)-4-(benzenesulfonylmethyl)-5,5-dimethylhexan-2-one.
| Compound Name | (4R)-4-(benzenesulfonylmethyl)-5,5-dimethylhexan-2-one |
|---|---|
| PubChem CID | 134906542 |
| Molecular Formula | C15H22O3S |
| Molecular Weight | 282.40 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | (4R)-4-(benzenesulfonylmethyl)-5,5-dimethylhexan-2-one |
| SMILES | CC(=O)C[C@@H](CS(=O)(=O)c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C15H22O3S/c1-12(16)10-13(15(2,3)4)11-19(17,18)14-8-6-5-7-9-14/h5-9,13H,10-11H2,1-4H3/t13-/m0/s1 |
| InChIKey | LCFGFLMEZBGPNE-ZDUSSCGKSA-N |
| XLogP | 3.10 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.40 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |