C22H35N4P3 — CID 134906744
2-diphenylphosphanyl-1-N,1-N,1-N',1-N',3-N,3-N,3-N',3-N'-octamethyl-1λ5,3λ5-diphosphacyclobuta-1,3-diene-1,1,3,3-tetramine (PubChem CID 134906744) has the molecular formula C22H35N4P3 and a molecular weight of 448.47 g/mol. Its IUPAC name is 2-diphenylphosphanyl-1-N,1-N,1-N',1-N',3-N,3-N,3-N',3-N'-octamethyl-1λ5,3λ5-diphosphacyclobuta-1,3-diene-1,1,3,3-tetramine.
| Compound Name | 2-diphenylphosphanyl-1-N,1-N,1-N',1-N',3-N,3-N,3-N',3-N'-octamethyl-1λ5,3λ5-diphosphacyclobuta-1,3-diene-1,1,3,3-tetramine |
|---|---|
| PubChem CID | 134906744 |
| Molecular Formula | C22H35N4P3 |
| Molecular Weight | 448.47 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | 2-diphenylphosphanyl-1-N,1-N,1-N',1-N',3-N,3-N,3-N',3-N'-octamethyl-1λ5,3λ5-diphosphacyclobuta-1,3-diene-1,1,3,3-tetramine |
| SMILES | CN(C)P1(N(C)C)=CP(N(C)C)(N(C)C)=C1P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H35N4P3/c1-23(2)28(24(3)4)19-29(25(5)6,26(7)8)22(28)27(20-15-11-9-12-16-20)21-17-13-10-14-18-21/h9-19H,1-8H3 |
| InChIKey | XWBHRZWPJNSFTJ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.47 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|