C21H25NO4 — CID 134906788
5-[cyclohexyl(1H-indol-3-yl)methyl]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 134906788) has the molecular formula C21H25NO4 and a molecular weight of 355.43 g/mol. Its IUPAC name is 5-[cyclohexyl(1H-indol-3-yl)methyl]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[cyclohexyl(1H-indol-3-yl)methyl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 134906788 |
| Molecular Formula | C21H25NO4 |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | 5-[cyclohexyl(1H-indol-3-yl)methyl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CC1(C)OC(=O)C(C(c2c[nH]c3ccccc23)C2CCCCC2)C(=O)O1 |
| InChI | InChI=1S/C21H25NO4/c1-21(2)25-19(23)18(20(24)26-21)17(13-8-4-3-5-9-13)15-12-22-16-11-7-6-10-14(15)16/h6-7,10-13,17-18,22H,3-5,8-9H2,1-2H3 |
| InChIKey | TVCJBADDUFQXLA-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 68.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|