C24H20F3NO2 — CID 134907072
1-benzyl-6-methoxy-3-(4-methoxyphenyl)-2-(trifluoromethyl)indole (PubChem CID 134907072) has the molecular formula C24H20F3NO2 and a molecular weight of 411.42 g/mol. Its IUPAC name is 1-benzyl-6-methoxy-3-(4-methoxyphenyl)-2-(trifluoromethyl)indole.
| Compound Name | 1-benzyl-6-methoxy-3-(4-methoxyphenyl)-2-(trifluoromethyl)indole |
|---|---|
| PubChem CID | 134907072 |
| Molecular Formula | C24H20F3NO2 |
| Molecular Weight | 411.42 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | 1-benzyl-6-methoxy-3-(4-methoxyphenyl)-2-(trifluoromethyl)indole |
| SMILES | COc1ccc(-c2c(C(F)(F)F)n(Cc3ccccc3)c3cc(OC)ccc23)cc1 |
| InChI | InChI=1S/C24H20F3NO2/c1-29-18-10-8-17(9-11-18)22-20-13-12-19(30-2)14-21(20)28(23(22)24(25,26)27)15-16-6-4-3-5-7-16/h3-14H,15H2,1-2H3 |
| InChIKey | FPSXOBJAWSGMSF-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 23.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.42 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |