C22H30NO3P — CID 134907504
N-bis(phenylmethoxy)phosphoryl-N-ethylcyclohexanamine (PubChem CID 134907504) has the molecular formula C22H30NO3P and a molecular weight of 387.46 g/mol. Its IUPAC name is N-bis(phenylmethoxy)phosphoryl-N-ethylcyclohexanamine.
| Compound Name | N-bis(phenylmethoxy)phosphoryl-N-ethylcyclohexanamine |
|---|---|
| PubChem CID | 134907504 |
| Molecular Formula | C22H30NO3P |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.20 |
| IUPAC Name | N-bis(phenylmethoxy)phosphoryl-N-ethylcyclohexanamine |
| SMILES | CCN(C1CCCCC1)P(=O)(OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C22H30NO3P/c1-2-23(22-16-10-5-11-17-22)27(24,25-18-20-12-6-3-7-13-20)26-19-21-14-8-4-9-15-21/h3-4,6-9,12-15,22H,2,5,10-11,16-19H2,1H3 |
| InChIKey | IMJLQUILCBAKHW-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|