C21H23NO4 — CID 134907718
ethyl (4R)-2-[(2R,3S)-2-methyl-3-phenyloxiran-2-yl]-4-phenyl-1,3-oxazolidine-3-carboxylate (PubChem CID 134907718) has the molecular formula C21H23NO4 and a molecular weight of 353.42 g/mol. Its IUPAC name is ethyl (4R)-2-[(2R,3S)-2-methyl-3-phenyloxiran-2-yl]-4-phenyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | ethyl (4R)-2-[(2R,3S)-2-methyl-3-phenyloxiran-2-yl]-4-phenyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 134907718 |
| Molecular Formula | C21H23NO4 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | ethyl (4R)-2-[(2R,3S)-2-methyl-3-phenyloxiran-2-yl]-4-phenyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CCOC(=O)N1C([C@]2(C)O[C@H]2c2ccccc2)OC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C21H23NO4/c1-3-24-20(23)22-17(15-10-6-4-7-11-15)14-25-19(22)21(2)18(26-21)16-12-8-5-9-13-16/h4-13,17-19H,3,14H2,1-2H3/t17-,18-,19?,21+/m0/s1 |
| InChIKey | RJVAMXMTACVOCT-TZARRNBISA-N |
| XLogP | 4.07 |
| TPSA | 51.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|