C25H23NO4S — CID 134907946
4-methylbenzenesulfonate;3-methyl-5-phenyl-2-[(E)-2-phenylethenyl]-1,3-oxazol-3-ium (PubChem CID 134907946) has the molecular formula C25H23NO4S and a molecular weight of 433.53 g/mol. Its IUPAC name is 4-methylbenzenesulfonate;3-methyl-5-phenyl-2-[(E)-2-phenylethenyl]-1,3-oxazol-3-ium.
| Compound Name | 4-methylbenzenesulfonate;3-methyl-5-phenyl-2-[(E)-2-phenylethenyl]-1,3-oxazol-3-ium |
|---|---|
| PubChem CID | 134907946 |
| Molecular Formula | C25H23NO4S |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | 4-methylbenzenesulfonate;3-methyl-5-phenyl-2-[(E)-2-phenylethenyl]-1,3-oxazol-3-ium |
| SMILES | C[n+]1cc(-c2ccccc2)oc1/C=C/c1ccccc1.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C18H16NO.C7H8O3S/c1-19-14-17(16-10-6-3-7-11-16)20-18(19)13-12-15-8-4-2-5-9-15;1-6-2-4-7(5-3-6)11(8,9)10/h2-14H,1H3;2-5H,1H3,(H,8,9,10)/q+1;/p-1/b13-12+; |
| InChIKey | IIAOLEUTLNBGNO-UEIGIMKUSA-M |
| XLogP | 4.84 |
| TPSA | 74.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|