C18H12N2O — CID 134909030
3-phenyl-5-[(E)-2-phenylethenyl]-1,2-oxazole-4-carbonitrile (PubChem CID 134909030) has the molecular formula C18H12N2O and a molecular weight of 272.31 g/mol. Its IUPAC name is 3-phenyl-5-[(E)-2-phenylethenyl]-1,2-oxazole-4-carbonitrile.
| Compound Name | 3-phenyl-5-[(E)-2-phenylethenyl]-1,2-oxazole-4-carbonitrile |
|---|---|
| PubChem CID | 134909030 |
| Molecular Formula | C18H12N2O |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | 3-phenyl-5-[(E)-2-phenylethenyl]-1,2-oxazole-4-carbonitrile |
| SMILES | N#Cc1c(-c2ccccc2)noc1/C=C/c1ccccc1 |
| InChI | InChI=1S/C18H12N2O/c19-13-16-17(12-11-14-7-3-1-4-8-14)21-20-18(16)15-9-5-2-6-10-15/h1-12H/b12-11+ |
| InChIKey | UDOSXLZBWXUMPB-VAWYXSNFSA-N |
| XLogP | 4.38 |
| TPSA | 49.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |