C15H15ClO7 — CID 134909296
1-[6-(4-methoxyphenyl)-2-methylpyrylium-3-yl]ethanone perchlorate (PubChem CID 134909296) has the molecular formula C15H15ClO7 and a molecular weight of 342.73 g/mol. Its IUPAC name is 1-[6-(4-methoxyphenyl)-2-methylpyrylium-3-yl]ethanone perchlorate.
| Compound Name | 1-[6-(4-methoxyphenyl)-2-methylpyrylium-3-yl]ethanone perchlorate |
|---|---|
| PubChem CID | 134909296 |
| Molecular Formula | C15H15ClO7 |
| Molecular Weight | 342.73 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | 1-[6-(4-methoxyphenyl)-2-methylpyrylium-3-yl]ethanone perchlorate |
| SMILES | COc1ccc(-c2ccc(C(C)=O)c(C)[o+]2)cc1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C15H15O3.ClHO4/c1-10(16)14-8-9-15(18-11(14)2)12-4-6-13(17-3)7-5-12;2-1(3,4)5/h4-9H,1-3H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | XAOFQRHTGJUDQV-UHFFFAOYSA-M |
| XLogP | -1.01 |
| TPSA | 129.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.73 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|