C19H17ClO7 — CID 2751505
2,4-bis(4-methoxyphenyl)pyrylium perchlorate (PubChem CID 2751505) has the molecular formula C19H17ClO7 and a molecular weight of 392.79 g/mol. Its IUPAC name is 2,4-bis(4-methoxyphenyl)pyrylium perchlorate.
| Compound Name | 2,4-bis(4-methoxyphenyl)pyrylium perchlorate |
|---|---|
| PubChem CID | 2751505 |
| Molecular Formula | C19H17ClO7 |
| Molecular Weight | 392.79 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | 2,4-bis(4-methoxyphenyl)pyrylium perchlorate |
| SMILES | COc1ccc(-c2cc[o+]c(-c3ccc(OC)cc3)c2)cc1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C19H17O3.ClHO4/c1-20-17-7-3-14(4-8-17)16-11-12-22-19(13-16)15-5-9-18(21-2)10-6-15;2-1(3,4)5/h3-13H,1-2H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | TYFCRMRPTHZCCD-UHFFFAOYSA-M |
| XLogP | 0.16 |
| TPSA | 122.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.79 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|