C35H28ClN3O5 — CID 134911424
1-(2,6-diphenylpyran-4-ylidene)-4,6,7-trimethyl-2-phenylimidazo[1,2-a]benzimidazol-4-ium perchlorate (PubChem CID 134911424) has the molecular formula C35H28ClN3O5 and a molecular weight of 606.08 g/mol. Its IUPAC name is 1-(2,6-diphenylpyran-4-ylidene)-4,6,7-trimethyl-2-phenylimidazo[1,2-a]benzimidazol-4-ium perchlorate.
| Compound Name | 1-(2,6-diphenylpyran-4-ylidene)-4,6,7-trimethyl-2-phenylimidazo[1,2-a]benzimidazol-4-ium perchlorate |
|---|---|
| PubChem CID | 134911424 |
| Molecular Formula | C35H28ClN3O5 |
| Molecular Weight | 606.08 g/mol |
| Exact Mass | 605.17 |
| IUPAC Name | 1-(2,6-diphenylpyran-4-ylidene)-4,6,7-trimethyl-2-phenylimidazo[1,2-a]benzimidazol-4-ium perchlorate |
| SMILES | Cc1cc2c(cc1C)[n+](C)c1nc(-c3ccccc3)c(=C3C=C(c4ccccc4)OC(c4ccccc4)=C3)n21.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C35H28N3O.ClHO4/c1-23-19-29-30(20-24(23)2)38-34(33(36-35(38)37(29)3)27-17-11-6-12-18-27)28-21-31(25-13-7-4-8-14-25)39-32(22-28)26-15-9-5-10-16-26;2-1(3,4)5/h4-22H,1-3H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | UCNPMGKAGGXELB-UHFFFAOYSA-M |
| XLogP | 1.82 |
| TPSA | 122.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.08 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|