C16H8ClNO3 — CID 134911848
8-chloro-3-phenylchromeno[3,4-d][1,2]oxazol-4-one (PubChem CID 134911848) has the molecular formula C16H8ClNO3 and a molecular weight of 297.70 g/mol. Its IUPAC name is 8-chloro-3-phenylchromeno[3,4-d][1,2]oxazol-4-one.
| Compound Name | 8-chloro-3-phenylchromeno[3,4-d][1,2]oxazol-4-one |
|---|---|
| PubChem CID | 134911848 |
| Molecular Formula | C16H8ClNO3 |
| Molecular Weight | 297.70 g/mol |
| Exact Mass | 297.02 |
| IUPAC Name | 8-chloro-3-phenylchromeno[3,4-d][1,2]oxazol-4-one |
| SMILES | O=c1oc2ccc(Cl)cc2c2onc(-c3ccccc3)c12 |
| InChI | InChI=1S/C16H8ClNO3/c17-10-6-7-12-11(8-10)15-13(16(19)20-12)14(18-21-15)9-4-2-1-3-5-9/h1-8H |
| InChIKey | YTXHQIGWXDNONS-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 56.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.70 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|