C13H10AlCl4N2PS — CID 134912483
3,5-diphenyl-1,3,4,2-thiadiazaphosphol-3-ium;tetrachloroalumanuide (PubChem CID 134912483) has the molecular formula C13H10AlCl4N2PS and a molecular weight of 426.07 g/mol. Its IUPAC name is 3,5-diphenyl-1,3,4,2-thiadiazaphosphol-3-ium;tetrachloroalumanuide.
| Compound Name | 3,5-diphenyl-1,3,4,2-thiadiazaphosphol-3-ium;tetrachloroalumanuide |
|---|---|
| PubChem CID | 134912483 |
| Molecular Formula | C13H10AlCl4N2PS |
| Molecular Weight | 426.07 g/mol |
| Exact Mass | 423.89 |
| IUPAC Name | 3,5-diphenyl-1,3,4,2-thiadiazaphosphol-3-ium;tetrachloroalumanuide |
| SMILES | Cl[Al-](Cl)(Cl)Cl.c1ccc(-c2n[n+](-c3ccccc3)ps2)cc1 |
| InChI | InChI=1S/C13H10N2PS.Al.4ClH/c1-3-7-11(8-4-1)13-14-15(16-17-13)12-9-5-2-6-10-12;;;;;/h1-10H;;4*1H/q+1;+3;;;;/p-4 |
| InChIKey | MSRNMZRRLAHDRJ-UHFFFAOYSA-J |
| XLogP | 6.04 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.07 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |