C14H12N2PS+ — CID 100943718
5-benzyl-3-phenyl-1,3,4,2-thiadiazaphosphol-3-ium (PubChem CID 100943718) has the molecular formula C14H12N2PS+ and a molecular weight of 271.31 g/mol. Its IUPAC name is 5-benzyl-3-phenyl-1,3,4,2-thiadiazaphosphol-3-ium.
| Compound Name | 5-benzyl-3-phenyl-1,3,4,2-thiadiazaphosphol-3-ium |
|---|---|
| PubChem CID | 100943718 |
| Molecular Formula | C14H12N2PS+ |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | 5-benzyl-3-phenyl-1,3,4,2-thiadiazaphosphol-3-ium |
| SMILES | c1ccc(Cc2n[n+](-c3ccccc3)ps2)cc1 |
| InChI | InChI=1S/C14H12N2PS/c1-3-7-12(8-4-1)11-14-15-16(17-18-14)13-9-5-2-6-10-13/h1-10H,11H2/q+1 |
| InChIKey | LUGKLMSPORWQFN-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |