C14H12ClN2PS — CID 15761690
5-benzyl-2-chloro-3-phenyl-1,3,4,2-thiadiazaphosphole (PubChem CID 15761690) has the molecular formula C14H12ClN2PS and a molecular weight of 306.76 g/mol. Its IUPAC name is 5-benzyl-2-chloro-3-phenyl-1,3,4,2-thiadiazaphosphole.
| Compound Name | 5-benzyl-2-chloro-3-phenyl-1,3,4,2-thiadiazaphosphole |
|---|---|
| PubChem CID | 15761690 |
| Molecular Formula | C14H12ClN2PS |
| Molecular Weight | 306.76 g/mol |
| Exact Mass | 306.01 |
| IUPAC Name | 5-benzyl-2-chloro-3-phenyl-1,3,4,2-thiadiazaphosphole |
| SMILES | ClP1SC(Cc2ccccc2)=NN1c1ccccc1 |
| InChI | InChI=1S/C14H12ClN2PS/c15-18-17(13-9-5-2-6-10-13)16-14(19-18)11-12-7-3-1-4-8-12/h1-10H,11H2 |
| InChIKey | YQYGDKIYXDGGAB-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.76 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|