About 3-chloro-2,5-diphenyl-4H-diazarsole
3-chloro-2,5-diphenyl-4H-diazarsole (PubChem CID 86012203) has the molecular formula C14H12AsClN2
and a molecular weight of 318.64 g/mol. Its IUPAC name is 3-chloro-2,5-diphenyl-4H-diazarsole.
Molecular Properties
| Compound Name | 3-chloro-2,5-diphenyl-4H-diazarsole |
| PubChem CID | 86012203 |
| Molecular Formula | C14H12AsClN2 |
| Molecular Weight | 318.64 g/mol |
| Exact Mass | 317.99 |
| IUPAC Name | 3-chloro-2,5-diphenyl-4H-diazarsole |
| SMILES | Cl[As]1CC(c2ccccc2)=NN1c1ccccc1 |
| InChI | InChI=1S/C14H12AsClN2/c16-15-11-14(12-7-3-1-4-8-12)17-18(15)13-9-5-2-6-10-13/h1-10H,11H2 |
| InChIKey | ZGRDXBFOLRUBHR-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.64 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-2,5-diphenyl-4H-diazarsole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-2,5-diphenyl-4H-diazarsole?
The IUPAC name of 3-chloro-2,5-diphenyl-4H-diazarsole (CID 86012203) is 3-chloro-2,5-diphenyl-4H-diazarsole.
What is the SMILES notation for 3-chloro-2,5-diphenyl-4H-diazarsole?
The canonical SMILES for 3-chloro-2,5-diphenyl-4H-diazarsole is Cl[As]1CC(c2ccccc2)=NN1c1ccccc1.
What is the InChIKey of 3-chloro-2,5-diphenyl-4H-diazarsole?
The InChIKey is ZGRDXBFOLRUBHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12AsClN2/c16-15-11-14(12-7-3-1-4-8-12)17-18(15)13-9-5-2-6-10-13/h1-10H,11H2.
What are the key properties of 3-chloro-2,5-diphenyl-4H-diazarsole?
3-chloro-2,5-diphenyl-4H-diazarsole has a molecular weight of 318.64 g/mol, XLogP of 3.64, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-2,5-diphenyl-4H-diazarsole is sourced from PubChem (CID 86012203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).