C9H10ClN2PS — CID 15761698
2-chloro-5-ethyl-3-phenyl-1,3,4,2-thiadiazaphosphole (PubChem CID 15761698) has the molecular formula C9H10ClN2PS and a molecular weight of 244.69 g/mol. Its IUPAC name is 2-chloro-5-ethyl-3-phenyl-1,3,4,2-thiadiazaphosphole.
| Compound Name | 2-chloro-5-ethyl-3-phenyl-1,3,4,2-thiadiazaphosphole |
|---|---|
| PubChem CID | 15761698 |
| Molecular Formula | C9H10ClN2PS |
| Molecular Weight | 244.69 g/mol |
| Exact Mass | 244.00 |
| IUPAC Name | 2-chloro-5-ethyl-3-phenyl-1,3,4,2-thiadiazaphosphole |
| SMILES | CCC1=NN(c2ccccc2)P(Cl)S1 |
| InChI | InChI=1S/C9H10ClN2PS/c1-2-9-11-12(13(10)14-9)8-6-4-3-5-7-8/h3-7H,2H2,1H3 |
| InChIKey | ARNJDBFNVKZWPA-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.69 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|