C8H8ClN2PS2 — CID 12516348
2-chloro-5-methylsulfanyl-3-phenyl-1,3,4,2-thiadiazaphosphole (PubChem CID 12516348) has the molecular formula C8H8ClN2PS2 and a molecular weight of 262.73 g/mol. Its IUPAC name is 2-chloro-5-methylsulfanyl-3-phenyl-1,3,4,2-thiadiazaphosphole.
| Compound Name | 2-chloro-5-methylsulfanyl-3-phenyl-1,3,4,2-thiadiazaphosphole |
|---|---|
| PubChem CID | 12516348 |
| Molecular Formula | C8H8ClN2PS2 |
| Molecular Weight | 262.73 g/mol |
| Exact Mass | 261.96 |
| IUPAC Name | 2-chloro-5-methylsulfanyl-3-phenyl-1,3,4,2-thiadiazaphosphole |
| SMILES | CSC1=NN(c2ccccc2)P(Cl)S1 |
| InChI | InChI=1S/C8H8ClN2PS2/c1-13-8-10-11(12(9)14-8)7-5-3-2-4-6-7/h2-6H,1H3 |
| InChIKey | XVHNSVMYFKDTIH-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.73 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|