C14H22N3PS2 — CID 15761682
5-methylsulfanyl-3-phenyl-N,N-di(propan-2-yl)-1,3,4,2-thiadiazaphosphol-2-amine (PubChem CID 15761682) has the molecular formula C14H22N3PS2 and a molecular weight of 327.46 g/mol. Its IUPAC name is 5-methylsulfanyl-3-phenyl-N,N-di(propan-2-yl)-1,3,4,2-thiadiazaphosphol-2-amine.
| Compound Name | 5-methylsulfanyl-3-phenyl-N,N-di(propan-2-yl)-1,3,4,2-thiadiazaphosphol-2-amine |
|---|---|
| PubChem CID | 15761682 |
| Molecular Formula | C14H22N3PS2 |
| Molecular Weight | 327.46 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | 5-methylsulfanyl-3-phenyl-N,N-di(propan-2-yl)-1,3,4,2-thiadiazaphosphol-2-amine |
| SMILES | CSC1=NN(c2ccccc2)P(N(C(C)C)C(C)C)S1 |
| InChI | InChI=1S/C14H22N3PS2/c1-11(2)16(12(3)4)18-17(15-14(19-5)20-18)13-9-7-6-8-10-13/h6-12H,1-5H3 |
| InChIKey | BIFDQSKLEMFGDC-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.46 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|