C16H18N3PS2 — CID 134912323
N,N-dimethyl-4-(5-methylsulfanyl-3-phenyl-1,3,4,2-thiadiazaphosphol-2-yl)aniline (PubChem CID 134912323) has the molecular formula C16H18N3PS2 and a molecular weight of 347.45 g/mol. Its IUPAC name is N,N-dimethyl-4-(5-methylsulfanyl-3-phenyl-1,3,4,2-thiadiazaphosphol-2-yl)aniline.
| Compound Name | N,N-dimethyl-4-(5-methylsulfanyl-3-phenyl-1,3,4,2-thiadiazaphosphol-2-yl)aniline |
|---|---|
| PubChem CID | 134912323 |
| Molecular Formula | C16H18N3PS2 |
| Molecular Weight | 347.45 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | N,N-dimethyl-4-(5-methylsulfanyl-3-phenyl-1,3,4,2-thiadiazaphosphol-2-yl)aniline |
| SMILES | CSC1=NN(c2ccccc2)P(c2ccc(N(C)C)cc2)S1 |
| InChI | InChI=1S/C16H18N3PS2/c1-18(2)13-9-11-15(12-10-13)20-19(17-16(21-3)22-20)14-7-5-4-6-8-14/h4-12H,1-3H3 |
| InChIKey | SONZGNGKQUDMLK-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.45 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|