C12H18N3PS2 — CID 12516349
N,N-diethyl-5-methylsulfanyl-3-phenyl-1,3,4,2-thiadiazaphosphol-2-amine (PubChem CID 12516349) has the molecular formula C12H18N3PS2 and a molecular weight of 299.41 g/mol. Its IUPAC name is N,N-diethyl-5-methylsulfanyl-3-phenyl-1,3,4,2-thiadiazaphosphol-2-amine.
| Compound Name | N,N-diethyl-5-methylsulfanyl-3-phenyl-1,3,4,2-thiadiazaphosphol-2-amine |
|---|---|
| PubChem CID | 12516349 |
| Molecular Formula | C12H18N3PS2 |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | N,N-diethyl-5-methylsulfanyl-3-phenyl-1,3,4,2-thiadiazaphosphol-2-amine |
| SMILES | CCN(CC)P1SC(SC)=NN1c1ccccc1 |
| InChI | InChI=1S/C12H18N3PS2/c1-4-14(5-2)16-15(13-12(17-3)18-16)11-9-7-6-8-10-11/h6-10H,4-5H2,1-3H3 |
| InChIKey | BNQNHPLUFFVTIV-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|