C8H8ClN2OP — CID 10921872
2-chloro-5-methyl-3-phenyl-1,3,4,2-oxadiazaphosphole (PubChem CID 10921872) has the molecular formula C8H8ClN2OP and a molecular weight of 214.59 g/mol. Its IUPAC name is 2-chloro-5-methyl-3-phenyl-1,3,4,2-oxadiazaphosphole.
| Compound Name | 2-chloro-5-methyl-3-phenyl-1,3,4,2-oxadiazaphosphole |
|---|---|
| PubChem CID | 10921872 |
| Molecular Formula | C8H8ClN2OP |
| Molecular Weight | 214.59 g/mol |
| Exact Mass | 214.01 |
| IUPAC Name | 2-chloro-5-methyl-3-phenyl-1,3,4,2-oxadiazaphosphole |
| SMILES | CC1=NN(c2ccccc2)P(Cl)O1 |
| InChI | InChI=1S/C8H8ClN2OP/c1-7-10-11(13(9)12-7)8-5-3-2-4-6-8/h2-6H,1H3 |
| InChIKey | BQQPPYSTFJXHAQ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.59 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|