C13H9BrClN2PS — CID 15761695
5-(4-bromophenyl)-2-chloro-3-phenyl-1,3,4,2-thiadiazaphosphole (PubChem CID 15761695) has the molecular formula C13H9BrClN2PS and a molecular weight of 371.63 g/mol. Its IUPAC name is 5-(4-bromophenyl)-2-chloro-3-phenyl-1,3,4,2-thiadiazaphosphole.
| Compound Name | 5-(4-bromophenyl)-2-chloro-3-phenyl-1,3,4,2-thiadiazaphosphole |
|---|---|
| PubChem CID | 15761695 |
| Molecular Formula | C13H9BrClN2PS |
| Molecular Weight | 371.63 g/mol |
| Exact Mass | 369.91 |
| IUPAC Name | 5-(4-bromophenyl)-2-chloro-3-phenyl-1,3,4,2-thiadiazaphosphole |
| SMILES | ClP1SC(c2ccc(Br)cc2)=NN1c1ccccc1 |
| InChI | InChI=1S/C13H9BrClN2PS/c14-11-8-6-10(7-9-11)13-16-17(18(15)19-13)12-4-2-1-3-5-12/h1-9H |
| InChIKey | VZUFELYZPVWRMF-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.63 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|