C9H4Cl3NO — CID 134912682
1,6,7-trichloro-2H-isoquinolin-3-one (PubChem CID 134912682) has the molecular formula C9H4Cl3NO and a molecular weight of 248.50 g/mol. Its IUPAC name is 1,6,7-trichloro-2H-isoquinolin-3-one.
| Compound Name | 1,6,7-trichloro-2H-isoquinolin-3-one |
|---|---|
| PubChem CID | 134912682 |
| Molecular Formula | C9H4Cl3NO |
| Molecular Weight | 248.50 g/mol |
| Exact Mass | 246.94 |
| IUPAC Name | 1,6,7-trichloro-2H-isoquinolin-3-one |
| SMILES | O=c1cc2cc(Cl)c(Cl)cc2c(Cl)[nH]1 |
| InChI | InChI=1S/C9H4Cl3NO/c10-6-1-4-2-8(14)13-9(12)5(4)3-7(6)11/h1-3H,(H,13,14) |
| InChIKey | XQFZGYHQPFVIED-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.50 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|