C9H5Cl2NO — CID 134989670
1,6-dichloro-2H-isoquinolin-3-one (PubChem CID 134989670) has the molecular formula C9H5Cl2NO and a molecular weight of 214.05 g/mol. Its IUPAC name is 1,6-dichloro-2H-isoquinolin-3-one.
| Compound Name | 1,6-dichloro-2H-isoquinolin-3-one |
|---|---|
| PubChem CID | 134989670 |
| Molecular Formula | C9H5Cl2NO |
| Molecular Weight | 214.05 g/mol |
| Exact Mass | 212.97 |
| IUPAC Name | 1,6-dichloro-2H-isoquinolin-3-one |
| SMILES | O=c1cc2cc(Cl)ccc2c(Cl)[nH]1 |
| InChI | InChI=1S/C9H5Cl2NO/c10-6-1-2-7-5(3-6)4-8(13)12-9(7)11/h1-4H,(H,12,13) |
| InChIKey | TUSRYKPFKDTIOE-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.05 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|