C16H20N2O3 — CID 134914638
tert-butyl 2-methyl-2-(4-oxo-3H-phthalazin-1-yl)propanoate (PubChem CID 134914638) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is tert-butyl 2-methyl-2-(4-oxo-3H-phthalazin-1-yl)propanoate.
| Compound Name | tert-butyl 2-methyl-2-(4-oxo-3H-phthalazin-1-yl)propanoate |
|---|---|
| PubChem CID | 134914638 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | tert-butyl 2-methyl-2-(4-oxo-3H-phthalazin-1-yl)propanoate |
| SMILES | CC(C)(C)OC(=O)C(C)(C)c1n[nH]c(=O)c2ccccc12 |
| InChI | InChI=1S/C16H20N2O3/c1-15(2,3)21-14(20)16(4,5)12-10-8-6-7-9-11(10)13(19)18-17-12/h6-9H,1-5H3,(H,18,19) |
| InChIKey | ULBXDDKLTKAINE-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |