C20H22N4O3S — CID 163859841
tert-butyl N-[4-[(4-oxo-3H-phthalazin-1-yl)methyl]anilino]sulfanylcarbamate (PubChem CID 163859841) has the molecular formula C20H22N4O3S and a molecular weight of 398.49 g/mol. Its IUPAC name is tert-butyl N-[4-[(4-oxo-3H-phthalazin-1-yl)methyl]anilino]sulfanylcarbamate.
| Compound Name | tert-butyl N-[4-[(4-oxo-3H-phthalazin-1-yl)methyl]anilino]sulfanylcarbamate |
|---|---|
| PubChem CID | 163859841 |
| Molecular Formula | C20H22N4O3S |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | tert-butyl N-[4-[(4-oxo-3H-phthalazin-1-yl)methyl]anilino]sulfanylcarbamate |
| SMILES | CC(C)(C)OC(=O)NSNc1ccc(Cc2n[nH]c(=O)c3ccccc23)cc1 |
| InChI | InChI=1S/C20H22N4O3S/c1-20(2,3)27-19(26)24-28-23-14-10-8-13(9-11-14)12-17-15-6-4-5-7-16(15)18(25)22-21-17/h4-11,23H,12H2,1-3H3,(H,22,25)(H,24,26) |
| InChIKey | PBNHFECQOZQXQX-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 96.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|