C35H35N2O2+ — CID 134915006
(1E)-5-phenyl-1-[[2-(2,4,6-trimethylbenzoyl)phenyl]-(2,4,6-trimethylphenyl)methylidene]pyrazolidin-1-ium-3-one (PubChem CID 134915006) has the molecular formula C35H35N2O2+ and a molecular weight of 515.68 g/mol. Its IUPAC name is (1E)-5-phenyl-1-[[2-(2,4,6-trimethylbenzoyl)phenyl]-(2,4,6-trimethylphenyl)methylidene]pyrazolidin-1-ium-3-one.
| Compound Name | (1E)-5-phenyl-1-[[2-(2,4,6-trimethylbenzoyl)phenyl]-(2,4,6-trimethylphenyl)methylidene]pyrazolidin-1-ium-3-one |
|---|---|
| PubChem CID | 134915006 |
| Molecular Formula | C35H35N2O2+ |
| Molecular Weight | 515.68 g/mol |
| Exact Mass | 515.27 |
| IUPAC Name | (1E)-5-phenyl-1-[[2-(2,4,6-trimethylbenzoyl)phenyl]-(2,4,6-trimethylphenyl)methylidene]pyrazolidin-1-ium-3-one |
| SMILES | Cc1cc(C)c(C(=O)c2ccccc2/C(c2c(C)cc(C)cc2C)=[N+]2\NC(=O)CC2c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C35H34N2O2/c1-21-16-23(3)32(24(4)17-21)34(37-30(20-31(38)36-37)27-12-8-7-9-13-27)28-14-10-11-15-29(28)35(39)33-25(5)18-22(2)19-26(33)6/h7-19,30H,20H2,1-6H3/p+1 |
| InChIKey | UVBHYOSEMUCFJM-UHFFFAOYSA-O |
| XLogP | 6.79 |
| TPSA | 49.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.68 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|