C22H22N4S — CID 134915161
3-benzyl-4-[4-(dimethylamino)phenyl]-4H-pyrido[1,2-a][1,3,5]triazine-2-thione (PubChem CID 134915161) has the molecular formula C22H22N4S and a molecular weight of 374.51 g/mol. Its IUPAC name is 3-benzyl-4-[4-(dimethylamino)phenyl]-4H-pyrido[1,2-a][1,3,5]triazine-2-thione.
| Compound Name | 3-benzyl-4-[4-(dimethylamino)phenyl]-4H-pyrido[1,2-a][1,3,5]triazine-2-thione |
|---|---|
| PubChem CID | 134915161 |
| Molecular Formula | C22H22N4S |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | 3-benzyl-4-[4-(dimethylamino)phenyl]-4H-pyrido[1,2-a][1,3,5]triazine-2-thione |
| SMILES | CN(C)c1ccc(C2N3C=CC=CC3=NC(=S)N2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C22H22N4S/c1-24(2)19-13-11-18(12-14-19)21-25-15-7-6-10-20(25)23-22(27)26(21)16-17-8-4-3-5-9-17/h3-15,21H,16H2,1-2H3 |
| InChIKey | JGSWEYIVCAZHHV-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 22.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|