C14H25N3O5 — CID 134915239
2-(2-ethylbutanoylcarbamoylcarbamoylamino)-3,3-dimethylbutanoic acid (PubChem CID 134915239) has the molecular formula C14H25N3O5 and a molecular weight of 315.37 g/mol. Its IUPAC name is 2-(2-ethylbutanoylcarbamoylcarbamoylamino)-3,3-dimethylbutanoic acid.
| Compound Name | 2-(2-ethylbutanoylcarbamoylcarbamoylamino)-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 134915239 |
| Molecular Formula | C14H25N3O5 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | 2-(2-ethylbutanoylcarbamoylcarbamoylamino)-3,3-dimethylbutanoic acid |
| SMILES | CCC(CC)C(=O)NC(=O)NC(=O)NC(C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C14H25N3O5/c1-6-8(7-2)10(18)16-13(22)17-12(21)15-9(11(19)20)14(3,4)5/h8-9H,6-7H2,1-5H3,(H,19,20)(H3,15,16,17,18,21,22) |
| InChIKey | BQGIOAZTTTYXJA-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |