C10F16 — CID 134916025
(4E)-3-(difluoromethylidene)-1,1,2-trifluoro-4-(1,2,2,3,3,3-hexafluoropropylidene)-2-(1,1,2,2,2-pentafluoroethyl)cyclobutane (PubChem CID 134916025) has the molecular formula C10F16 and a molecular weight of 424.08 g/mol. Its IUPAC name is (4E)-3-(difluoromethylidene)-1,1,2-trifluoro-4-(1,2,2,3,3,3-hexafluoropropylidene)-2-(1,1,2,2,2-pentafluoroethyl)cyclobutane.
| Compound Name | (4E)-3-(difluoromethylidene)-1,1,2-trifluoro-4-(1,2,2,3,3,3-hexafluoropropylidene)-2-(1,1,2,2,2-pentafluoroethyl)cyclobutane |
|---|---|
| PubChem CID | 134916025 |
| Molecular Formula | C10F16 |
| Molecular Weight | 424.08 g/mol |
| Exact Mass | 423.97 |
| IUPAC Name | (4E)-3-(difluoromethylidene)-1,1,2-trifluoro-4-(1,2,2,3,3,3-hexafluoropropylidene)-2-(1,1,2,2,2-pentafluoroethyl)cyclobutane |
| SMILES | FC(F)=C1/C(=C(\F)C(F)(F)C(F)(F)F)C(F)(F)C1(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10F16/c11-3(7(17,18)9(21,22)23)1-2(4(12)13)5(14,6(1,15)16)8(19,20)10(24,25)26/b3-1+ |
| InChIKey | VNUVDKPLFKAYIJ-HNQUOIGGSA-N |
| XLogP | 6.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.08 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|