C12F20 — CID 12710296
(4E)-1-fluoro-4-[1,1,1,3,4,4,4-heptafluoro-3-(trifluoromethyl)butan-2-ylidene]-2,3,3-tris(trifluoromethyl)cyclobutene (PubChem CID 12710296) has the molecular formula C12F20 and a molecular weight of 524.09 g/mol. Its IUPAC name is (4E)-1-fluoro-4-[1,1,1,3,4,4,4-heptafluoro-3-(trifluoromethyl)butan-2-ylidene]-2,3,3-tris(trifluoromethyl)cyclobutene.
| Compound Name | (4E)-1-fluoro-4-[1,1,1,3,4,4,4-heptafluoro-3-(trifluoromethyl)butan-2-ylidene]-2,3,3-tris(trifluoromethyl)cyclobutene |
|---|---|
| PubChem CID | 12710296 |
| Molecular Formula | C12F20 |
| Molecular Weight | 524.09 g/mol |
| Exact Mass | 523.97 |
| IUPAC Name | (4E)-1-fluoro-4-[1,1,1,3,4,4,4-heptafluoro-3-(trifluoromethyl)butan-2-ylidene]-2,3,3-tris(trifluoromethyl)cyclobutene |
| SMILES | FC1=C(C(F)(F)F)C(C(F)(F)F)(C(F)(F)F)/C1=C(\C(F)(F)F)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12F20/c13-2-1(3(7(15,16)17)6(14,11(27,28)29)12(30,31)32)5(9(21,22)23,10(24,25)26)4(2)8(18,19)20/b3-1- |
| InChIKey | LMWNUTUHPWLPJX-IWQZZHSRSA-N |
| XLogP | 7.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.09 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |