C11F18 — CID 11762501
1,2,3,4,5,5-hexakis(trifluoromethyl)cyclopenta-1,3-diene (PubChem CID 11762501) has the molecular formula C11F18 and a molecular weight of 474.09 g/mol. Its IUPAC name is 1,2,3,4,5,5-hexakis(trifluoromethyl)cyclopenta-1,3-diene.
| Compound Name | 1,2,3,4,5,5-hexakis(trifluoromethyl)cyclopenta-1,3-diene |
|---|---|
| PubChem CID | 11762501 |
| Molecular Formula | C11F18 |
| Molecular Weight | 474.09 g/mol |
| Exact Mass | 473.97 |
| IUPAC Name | 1,2,3,4,5,5-hexakis(trifluoromethyl)cyclopenta-1,3-diene |
| SMILES | FC(F)(F)C1=C(C(F)(F)F)C(C(F)(F)F)(C(F)(F)F)C(C(F)(F)F)=C1C(F)(F)F |
| InChI | InChI=1S/C11F18/c12-6(13,14)1-2(7(15,16)17)4(9(21,22)23)5(10(24,25)26,11(27,28)29)3(1)8(18,19)20 |
| InChIKey | FORVOHAOZHHYML-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.09 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |