C27H34O3 — CID 134916334
[(1S)-1-[(1S,2S,3aR,6aR)-2-hydroxy-1-methyl-3,3a,4,5,6,6a-hexahydro-2H-pentalen-1-yl]-3-phenylpropyl] 3-phenylpropanoate (PubChem CID 134916334) has the molecular formula C27H34O3 and a molecular weight of 406.57 g/mol. Its IUPAC name is [(1S)-1-[(1S,2S,3aR,6aR)-2-hydroxy-1-methyl-3,3a,4,5,6,6a-hexahydro-2H-pentalen-1-yl]-3-phenylpropyl] 3-phenylpropanoate.
| Compound Name | [(1S)-1-[(1S,2S,3aR,6aR)-2-hydroxy-1-methyl-3,3a,4,5,6,6a-hexahydro-2H-pentalen-1-yl]-3-phenylpropyl] 3-phenylpropanoate |
|---|---|
| PubChem CID | 134916334 |
| Molecular Formula | C27H34O3 |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.25 |
| IUPAC Name | [(1S)-1-[(1S,2S,3aR,6aR)-2-hydroxy-1-methyl-3,3a,4,5,6,6a-hexahydro-2H-pentalen-1-yl]-3-phenylpropyl] 3-phenylpropanoate |
| SMILES | C[C@]1([C@H](CCc2ccccc2)OC(=O)CCc2ccccc2)[C@@H]2CCC[C@@H]2C[C@@H]1O |
| InChI | InChI=1S/C27H34O3/c1-27(23-14-8-13-22(23)19-24(27)28)25(17-15-20-9-4-2-5-10-20)30-26(29)18-16-21-11-6-3-7-12-21/h2-7,9-12,22-25,28H,8,13-19H2,1H3/t22-,23-,24+,25+,27+/m1/s1 |
| InChIKey | GBKAAXMTYPYADL-RYIFMDQWSA-N |
| XLogP | 5.35 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |