C26H38O6Si — CID 134916488
methyl (Z)-3-[(1S,2S,3S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-formyl-3-methyl-1-phenylmethoxy-7-oxabicyclo[4.2.0]octan-3-yl]prop-2-enoate (PubChem CID 134916488) has the molecular formula C26H38O6Si and a molecular weight of 474.67 g/mol. Its IUPAC name is methyl (Z)-3-[(1S,2S,3S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-formyl-3-methyl-1-phenylmethoxy-7-oxabicyclo[4.2.0]octan-3-yl]prop-2-enoate.
| Compound Name | methyl (Z)-3-[(1S,2S,3S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-formyl-3-methyl-1-phenylmethoxy-7-oxabicyclo[4.2.0]octan-3-yl]prop-2-enoate |
|---|---|
| PubChem CID | 134916488 |
| Molecular Formula | C26H38O6Si |
| Molecular Weight | 474.67 g/mol |
| Exact Mass | 474.24 |
| IUPAC Name | methyl (Z)-3-[(1S,2S,3S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-formyl-3-methyl-1-phenylmethoxy-7-oxabicyclo[4.2.0]octan-3-yl]prop-2-enoate |
| SMILES | COC(=O)/C=C\[C@]1(C)[C@@H](O[Si](C)(C)C(C)(C)C)CC2OC[C@@]2(OCc2ccccc2)[C@H]1C=O |
| InChI | InChI=1S/C26H38O6Si/c1-24(2,3)33(6,7)32-21-15-22-26(18-30-22,31-17-19-11-9-8-10-12-19)20(16-27)25(21,4)14-13-23(28)29-5/h8-14,16,20-22H,15,17-18H2,1-7H3/b14-13-/t20-,21-,22?,25-,26+/m0/s1 |
| InChIKey | CHJVXEGNNMJQOE-BNVLYFMDSA-N |
| XLogP | 4.69 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.67 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|