C16H22ClNS — CID 134917428
N-cyclohexyl-1-(2,4,6-trimethylphenyl)sulfanylmethanimidoyl chloride (PubChem CID 134917428) has the molecular formula C16H22ClNS and a molecular weight of 295.88 g/mol. Its IUPAC name is N-cyclohexyl-1-(2,4,6-trimethylphenyl)sulfanylmethanimidoyl chloride.
| Compound Name | N-cyclohexyl-1-(2,4,6-trimethylphenyl)sulfanylmethanimidoyl chloride |
|---|---|
| PubChem CID | 134917428 |
| Molecular Formula | C16H22ClNS |
| Molecular Weight | 295.88 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | N-cyclohexyl-1-(2,4,6-trimethylphenyl)sulfanylmethanimidoyl chloride |
| SMILES | Cc1cc(C)c(S/C(Cl)=N/C2CCCCC2)c(C)c1 |
| InChI | InChI=1S/C16H22ClNS/c1-11-9-12(2)15(13(3)10-11)19-16(17)18-14-7-5-4-6-8-14/h9-10,14H,4-8H2,1-3H3/b18-16+ |
| InChIKey | VAALMMAZVUJVEY-FBMGVBCBSA-N |
| XLogP | 5.63 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.88 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|