C13H18ClNS — CID 134917334
N-propan-2-yl-1-(2,4,6-trimethylphenyl)sulfanylmethanimidoyl chloride (PubChem CID 134917334) has the molecular formula C13H18ClNS and a molecular weight of 255.81 g/mol. Its IUPAC name is N-propan-2-yl-1-(2,4,6-trimethylphenyl)sulfanylmethanimidoyl chloride.
| Compound Name | N-propan-2-yl-1-(2,4,6-trimethylphenyl)sulfanylmethanimidoyl chloride |
|---|---|
| PubChem CID | 134917334 |
| Molecular Formula | C13H18ClNS |
| Molecular Weight | 255.81 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | N-propan-2-yl-1-(2,4,6-trimethylphenyl)sulfanylmethanimidoyl chloride |
| SMILES | Cc1cc(C)c(S/C(Cl)=N/C(C)C)c(C)c1 |
| InChI | InChI=1S/C13H18ClNS/c1-8(2)15-13(14)16-12-10(4)6-9(3)7-11(12)5/h6-8H,1-5H3/b15-13+ |
| InChIKey | JDDBWSGRVCFLSF-FYWRMAATSA-N |
| XLogP | 4.71 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.81 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|