C15H25NS — CID 23232789
N-[(2,6-dimethylphenyl)sulfanylmethyl]-N-propan-2-ylpropan-2-amine (PubChem CID 23232789) has the molecular formula C15H25NS and a molecular weight of 251.44 g/mol. Its IUPAC name is N-[(2,6-dimethylphenyl)sulfanylmethyl]-N-propan-2-ylpropan-2-amine.
| Compound Name | N-[(2,6-dimethylphenyl)sulfanylmethyl]-N-propan-2-ylpropan-2-amine |
|---|---|
| PubChem CID | 23232789 |
| Molecular Formula | C15H25NS |
| Molecular Weight | 251.44 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | N-[(2,6-dimethylphenyl)sulfanylmethyl]-N-propan-2-ylpropan-2-amine |
| SMILES | Cc1cccc(C)c1SCN(C(C)C)C(C)C |
| InChI | InChI=1S/C15H25NS/c1-11(2)16(12(3)4)10-17-15-13(5)8-7-9-14(15)6/h7-9,11-12H,10H2,1-6H3 |
| InChIKey | KWQCVDZMLXLTHU-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.44 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|