C12H19NS — CID 82283991
1-(2,4,6-trimethylphenyl)sulfanylpropan-2-amine (PubChem CID 82283991) has the molecular formula C12H19NS and a molecular weight of 209.36 g/mol. Its IUPAC name is 1-(2,4,6-trimethylphenyl)sulfanylpropan-2-amine.
| Compound Name | 1-(2,4,6-trimethylphenyl)sulfanylpropan-2-amine |
|---|---|
| PubChem CID | 82283991 |
| Molecular Formula | C12H19NS |
| Molecular Weight | 209.36 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 1-(2,4,6-trimethylphenyl)sulfanylpropan-2-amine |
| SMILES | Cc1cc(C)c(SCC(C)N)c(C)c1 |
| InChI | InChI=1S/C12H19NS/c1-8-5-9(2)12(10(3)6-8)14-7-11(4)13/h5-6,11H,7,13H2,1-4H3 |
| InChIKey | NDGHHGRSPFYNTF-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.36 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |