C16H17NO2S — CID 134917603
3-hydroxy-4-phenyl-2-phenylsulfanylbutanamide (PubChem CID 134917603) has the molecular formula C16H17NO2S and a molecular weight of 287.38 g/mol. Its IUPAC name is 3-hydroxy-4-phenyl-2-phenylsulfanylbutanamide.
| Compound Name | 3-hydroxy-4-phenyl-2-phenylsulfanylbutanamide |
|---|---|
| PubChem CID | 134917603 |
| Molecular Formula | C16H17NO2S |
| Molecular Weight | 287.38 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 3-hydroxy-4-phenyl-2-phenylsulfanylbutanamide |
| SMILES | NC(=O)C(Sc1ccccc1)C(O)Cc1ccccc1 |
| InChI | InChI=1S/C16H17NO2S/c17-16(19)15(20-13-9-5-2-6-10-13)14(18)11-12-7-3-1-4-8-12/h1-10,14-15,18H,11H2,(H2,17,19) |
| InChIKey | IOEGMKDIWXEHMN-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.38 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |