C18H27NO3S — CID 67135102
5-hydroxy-5-[3-[(1-hydroxycyclohexyl)methylsulfanyl]phenyl]pentanamide (PubChem CID 67135102) has the molecular formula C18H27NO3S and a molecular weight of 337.49 g/mol. Its IUPAC name is 5-hydroxy-5-[3-[(1-hydroxycyclohexyl)methylsulfanyl]phenyl]pentanamide.
| Compound Name | 5-hydroxy-5-[3-[(1-hydroxycyclohexyl)methylsulfanyl]phenyl]pentanamide |
|---|---|
| PubChem CID | 67135102 |
| Molecular Formula | C18H27NO3S |
| Molecular Weight | 337.49 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | 5-hydroxy-5-[3-[(1-hydroxycyclohexyl)methylsulfanyl]phenyl]pentanamide |
| SMILES | NC(=O)CCCC(O)c1cccc(SCC2(O)CCCCC2)c1 |
| InChI | InChI=1S/C18H27NO3S/c19-17(21)9-5-8-16(20)14-6-4-7-15(12-14)23-13-18(22)10-2-1-3-11-18/h4,6-7,12,16,20,22H,1-3,5,8-11,13H2,(H2,19,21) |
| InChIKey | WRUKKARNVWJOFA-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.49 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |