C16H25NO3S — CID 90903545
[3-(3-amino-1-hydroxypropyl)phenyl]sulfanyl-cyclohexylmethanediol (PubChem CID 90903545) has the molecular formula C16H25NO3S and a molecular weight of 311.45 g/mol. Its IUPAC name is [3-(3-amino-1-hydroxypropyl)phenyl]sulfanyl-cyclohexylmethanediol.
| Compound Name | [3-(3-amino-1-hydroxypropyl)phenyl]sulfanyl-cyclohexylmethanediol |
|---|---|
| PubChem CID | 90903545 |
| Molecular Formula | C16H25NO3S |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | [3-(3-amino-1-hydroxypropyl)phenyl]sulfanyl-cyclohexylmethanediol |
| SMILES | NCCC(O)c1cccc(SC(O)(O)C2CCCCC2)c1 |
| InChI | InChI=1S/C16H25NO3S/c17-10-9-15(18)12-5-4-8-14(11-12)21-16(19,20)13-6-2-1-3-7-13/h4-5,8,11,13,15,18-20H,1-3,6-7,9-10,17H2 |
| InChIKey | RJUQJQYOIVGGPV-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|