C17H29NO2S — CID 67130321
4-[[3-(3-amino-1-hydroxypropyl)phenyl]sulfanylmethyl]heptan-1-ol (PubChem CID 67130321) has the molecular formula C17H29NO2S and a molecular weight of 311.49 g/mol. Its IUPAC name is 4-[[3-(3-amino-1-hydroxypropyl)phenyl]sulfanylmethyl]heptan-1-ol.
| Compound Name | 4-[[3-(3-amino-1-hydroxypropyl)phenyl]sulfanylmethyl]heptan-1-ol |
|---|---|
| PubChem CID | 67130321 |
| Molecular Formula | C17H29NO2S |
| Molecular Weight | 311.49 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | 4-[[3-(3-amino-1-hydroxypropyl)phenyl]sulfanylmethyl]heptan-1-ol |
| SMILES | CCCC(CCCO)CSc1cccc(C(O)CCN)c1 |
| InChI | InChI=1S/C17H29NO2S/c1-2-5-14(6-4-11-19)13-21-16-8-3-7-15(12-16)17(20)9-10-18/h3,7-8,12,14,17,19-20H,2,4-6,9-11,13,18H2,1H3 |
| InChIKey | FHRNEWFIGCPAQF-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.49 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |