C18H31NO3 — CID 91159360
1-[3-(3-amino-1-hydroxypropyl)phenyl]-3-ethylheptane-1,1-diol (PubChem CID 91159360) has the molecular formula C18H31NO3 and a molecular weight of 309.45 g/mol. Its IUPAC name is 1-[3-(3-amino-1-hydroxypropyl)phenyl]-3-ethylheptane-1,1-diol.
| Compound Name | 1-[3-(3-amino-1-hydroxypropyl)phenyl]-3-ethylheptane-1,1-diol |
|---|---|
| PubChem CID | 91159360 |
| Molecular Formula | C18H31NO3 |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.23 |
| IUPAC Name | 1-[3-(3-amino-1-hydroxypropyl)phenyl]-3-ethylheptane-1,1-diol |
| SMILES | CCCCC(CC)CC(O)(O)c1cccc(C(O)CCN)c1 |
| InChI | InChI=1S/C18H31NO3/c1-3-5-7-14(4-2)13-18(21,22)16-9-6-8-15(12-16)17(20)10-11-19/h6,8-9,12,14,17,20-22H,3-5,7,10-11,13,19H2,1-2H3 |
| InChIKey | JAUPQOKOBGPROB-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|