C16H26OS — CID 64665322
1-[3-(2-ethylhexylsulfanyl)phenyl]ethanol (PubChem CID 64665322) has the molecular formula C16H26OS and a molecular weight of 266.45 g/mol. Its IUPAC name is 1-[3-(2-ethylhexylsulfanyl)phenyl]ethanol.
| Compound Name | 1-[3-(2-ethylhexylsulfanyl)phenyl]ethanol |
|---|---|
| PubChem CID | 64665322 |
| Molecular Formula | C16H26OS |
| Molecular Weight | 266.45 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | 1-[3-(2-ethylhexylsulfanyl)phenyl]ethanol |
| SMILES | CCCCC(CC)CSc1cccc(C(C)O)c1 |
| InChI | InChI=1S/C16H26OS/c1-4-6-8-14(5-2)12-18-16-10-7-9-15(11-16)13(3)17/h7,9-11,13-14,17H,4-6,8,12H2,1-3H3 |
| InChIKey | JNOKFMDYVRIQAU-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.45 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |