C16H27NS — CID 66348605
1-[3-(2-ethylhexylsulfanyl)phenyl]-N-methylmethanamine (PubChem CID 66348605) has the molecular formula C16H27NS and a molecular weight of 265.47 g/mol. Its IUPAC name is 1-[3-(2-ethylhexylsulfanyl)phenyl]-N-methylmethanamine.
| Compound Name | 1-[3-(2-ethylhexylsulfanyl)phenyl]-N-methylmethanamine |
|---|---|
| PubChem CID | 66348605 |
| Molecular Formula | C16H27NS |
| Molecular Weight | 265.47 g/mol |
| Exact Mass | 265.19 |
| IUPAC Name | 1-[3-(2-ethylhexylsulfanyl)phenyl]-N-methylmethanamine |
| SMILES | CCCCC(CC)CSc1cccc(CNC)c1 |
| InChI | InChI=1S/C16H27NS/c1-4-6-8-14(5-2)13-18-16-10-7-9-15(11-16)12-17-3/h7,9-11,14,17H,4-6,8,12-13H2,1-3H3 |
| InChIKey | XYPPZXWWVDOQPJ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.47 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |