C17H28N2O3S — CID 59316910
N-[3-(3-amino-1-hydroxypropyl)phenyl]-2-cyclohexylethanesulfonamide (PubChem CID 59316910) has the molecular formula C17H28N2O3S and a molecular weight of 340.49 g/mol. Its IUPAC name is N-[3-(3-amino-1-hydroxypropyl)phenyl]-2-cyclohexylethanesulfonamide.
| Compound Name | N-[3-(3-amino-1-hydroxypropyl)phenyl]-2-cyclohexylethanesulfonamide |
|---|---|
| PubChem CID | 59316910 |
| Molecular Formula | C17H28N2O3S |
| Molecular Weight | 340.49 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | N-[3-(3-amino-1-hydroxypropyl)phenyl]-2-cyclohexylethanesulfonamide |
| SMILES | NCCC(O)c1cccc(NS(=O)(=O)CCC2CCCCC2)c1 |
| InChI | InChI=1S/C17H28N2O3S/c18-11-9-17(20)15-7-4-8-16(13-15)19-23(21,22)12-10-14-5-2-1-3-6-14/h4,7-8,13-14,17,19-20H,1-3,5-6,9-12,18H2 |
| InChIKey | LPFZNFRPKLORFG-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.49 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |