C17H31N3O3S — CID 70411803
1-[4-hydroxy-4-[3-(sulfamoylamino)phenyl]butyl]azepane;methane (PubChem CID 70411803) has the molecular formula C17H31N3O3S and a molecular weight of 357.52 g/mol. Its IUPAC name is 1-[4-hydroxy-4-[3-(sulfamoylamino)phenyl]butyl]azepane;methane.
| Compound Name | 1-[4-hydroxy-4-[3-(sulfamoylamino)phenyl]butyl]azepane;methane |
|---|---|
| PubChem CID | 70411803 |
| Molecular Formula | C17H31N3O3S |
| Molecular Weight | 357.52 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | 1-[4-hydroxy-4-[3-(sulfamoylamino)phenyl]butyl]azepane;methane |
| SMILES | C.NS(=O)(=O)Nc1cccc(C(O)CCCN2CCCCCC2)c1 |
| InChI | InChI=1S/C16H27N3O3S.CH4/c17-23(21,22)18-15-8-5-7-14(13-15)16(20)9-6-12-19-10-3-1-2-4-11-19;/h5,7-8,13,16,18,20H,1-4,6,9-12H2,(H2,17,21,22);1H4 |
| InChIKey | JITVPPAWDBCPFL-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.52 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |