C15H27N3O2S — CID 70410715
methane;1-[2-[3-(sulfamoylamino)phenyl]ethyl]azepane (PubChem CID 70410715) has the molecular formula C15H27N3O2S and a molecular weight of 313.47 g/mol. Its IUPAC name is methane;1-[2-[3-(sulfamoylamino)phenyl]ethyl]azepane.
| Compound Name | methane;1-[2-[3-(sulfamoylamino)phenyl]ethyl]azepane |
|---|---|
| PubChem CID | 70410715 |
| Molecular Formula | C15H27N3O2S |
| Molecular Weight | 313.47 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | methane;1-[2-[3-(sulfamoylamino)phenyl]ethyl]azepane |
| SMILES | C.NS(=O)(=O)Nc1cccc(CCN2CCCCCC2)c1 |
| InChI | InChI=1S/C14H23N3O2S.CH4/c15-20(18,19)16-14-7-5-6-13(12-14)8-11-17-9-3-1-2-4-10-17;/h5-7,12,16H,1-4,8-11H2,(H2,15,18,19);1H4 |
| InChIKey | JZKSLZXJVTUSEW-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.47 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |